C35H51N3O5 — CID 18217700
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217700) has the molecular formula C35H51N3O5 and a molecular weight of 593.81 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217700 |
| Molecular Formula | C35H51N3O5 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C35H51N3O5/c1-5-6-7-8-15-24-38(31(27-20-22-29(39)23-21-27)32(40)36-28-18-13-10-14-19-28)33(41)30(25-26-16-11-9-12-17-26)37-34(42)43-35(2,3)4/h9,11-12,16-17,20-23,28,30-31,39H,5-8,10,13-15,18-19,24-25H2,1-4H3,(H,36,40)(H,37,42) |
| InChIKey | SYIWXIJFFWDJKC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|