C33H55N3O5 — CID 18049093
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18049093) has the molecular formula C33H55N3O5 and a molecular weight of 573.82 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18049093 |
| Molecular Formula | C33H55N3O5 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.41 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C33H55N3O5/c1-7-8-9-10-11-15-22-36(31(39)28(23-24(2)3)35-32(40)41-33(4,5)6)29(25-18-20-27(37)21-19-25)30(38)34-26-16-13-12-14-17-26/h18-21,24,26,28-29,37H,7-17,22-23H2,1-6H3,(H,34,38)(H,35,40) |
| InChIKey | FTEYSCOVTMAIBY-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|