C34H49N3O4 — CID 18216530
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18216530) has the molecular formula C34H49N3O4 and a molecular weight of 563.78 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18216530 |
| Molecular Formula | C34H49N3O4 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.37 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H49N3O4/c1-6-7-14-23-37(30(27-21-19-25(2)20-22-27)31(38)35-28-17-12-9-13-18-28)32(39)29(24-26-15-10-8-11-16-26)36-33(40)41-34(3,4)5/h8,10-11,15-16,19-22,28-30H,6-7,9,12-14,17-18,23-24H2,1-5H3,(H,35,38)(H,36,40) |
| InChIKey | XHBOBPMZDCJGJH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|