C34H51N3O4 — CID 18217666
tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217666) has the molecular formula C34H51N3O4 and a molecular weight of 565.80 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217666 |
| Molecular Formula | C34H51N3O4 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.39 |
| IUPAC Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H51N3O4/c1-9-10-11-12-16-23-37(29(30(38)36-33(3,4)5)27-21-19-25(2)20-22-27)31(39)28(24-26-17-14-13-15-18-26)35-32(40)41-34(6,7)8/h13-15,17-22,28-29H,9-12,16,23-24H2,1-8H3,(H,35,40)(H,36,38) |
| InChIKey | DOKVMRWNANORHH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|