C35H53N3O4 — CID 18218040
tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18218040) has the molecular formula C35H53N3O4 and a molecular weight of 579.83 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18218040 |
| Molecular Formula | C35H53N3O4 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.40 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC(C)C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C35H53N3O4/c1-8-10-11-12-13-17-24-38(31(32(39)36-26(3)4)29-22-20-27(9-2)21-23-29)33(40)30(25-28-18-15-14-16-19-28)37-34(41)42-35(5,6)7/h14-16,18-23,26,30-31H,8-13,17,24-25H2,1-7H3,(H,36,39)(H,37,41) |
| InChIKey | GQILPNQXYJLHHZ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|