C32H43N3O4 — CID 18216570
tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18216570) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18216570 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NC(C)C)N(CCCCC)C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H43N3O4/c1-8-10-14-21-35(28(29(36)33-23(3)4)26-19-17-24(9-2)18-20-26)30(37)27(22-25-15-12-11-13-16-25)34-31(38)39-32(5,6)7/h2,11-13,15-20,23,27-28H,8,10,14,21-22H2,1,3-7H3,(H,33,36)(H,34,38) |
| InChIKey | YBNRGKOVMVADMV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|