C40H57N3O6 — CID 18043130
tert-butyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]acetyl]amino]-3-phenylpropanoate (PubChem CID 18043130) has the molecular formula C40H57N3O6 and a molecular weight of 675.91 g/mol. Its IUPAC name is tert-butyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18043130 |
| Molecular Formula | C40H57N3O6 |
| Molecular Weight | 675.91 g/mol |
| Exact Mass | 675.42 |
| IUPAC Name | tert-butyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]acetyl]amino]-3-phenylpropanoate |
| SMILES | C#Cc1ccc(C(C(=O)NC(Cc2ccccc2)C(=O)OC(C)(C)C)N(CCCCCCC)C(=O)C(NC(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C40H57N3O6/c1-11-13-14-15-19-26-43(36(45)33(28(3)4)42-38(47)49-40(8,9)10)34(31-24-22-29(12-2)23-25-31)35(44)41-32(37(46)48-39(5,6)7)27-30-20-17-16-18-21-30/h2,16-18,20-25,28,32-34H,11,13-15,19,26-27H2,1,3-10H3,(H,41,44)(H,42,47) |
| InChIKey | JOTKIJRVBSYOTL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.91 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|