C42H61N3O6 — CID 18049115
tert-butyl 2-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]-3-phenylpropanoate (PubChem CID 18049115) has the molecular formula C42H61N3O6 and a molecular weight of 703.97 g/mol. Its IUPAC name is tert-butyl 2-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18049115 |
| Molecular Formula | C42H61N3O6 |
| Molecular Weight | 703.97 g/mol |
| Exact Mass | 703.46 |
| IUPAC Name | tert-butyl 2-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]-3-phenylpropanoate |
| SMILES | C#Cc1ccc(C(C(=O)NC(Cc2ccccc2)C(=O)OC(C)(C)C)N(CCCCCCCC)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C42H61N3O6/c1-11-13-14-15-16-20-27-45(38(47)34(28-30(3)4)44-40(49)51-42(8,9)10)36(33-25-23-31(12-2)24-26-33)37(46)43-35(39(48)50-41(5,6)7)29-32-21-18-17-19-22-32/h2,17-19,21-26,30,34-36H,11,13-16,20,27-29H2,1,3-10H3,(H,43,46)(H,44,49) |
| InChIKey | GHVLOSNVAFUDJY-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.97 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|