C38H51N3O4 — CID 18217956
tert-butyl N-[1-[[2-(benzylamino)-1-(4-methylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217956) has the molecular formula C38H51N3O4 and a molecular weight of 613.84 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(4-methylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(4-methylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217956 |
| Molecular Formula | C38H51N3O4 |
| Molecular Weight | 613.84 g/mol |
| Exact Mass | 613.39 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(4-methylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C38H51N3O4/c1-6-7-8-9-10-17-26-41(36(43)33(27-30-18-13-11-14-19-30)40-37(44)45-38(3,4)5)34(32-24-22-29(2)23-25-32)35(42)39-28-31-20-15-12-16-21-31/h11-16,18-25,33-34H,6-10,17,26-28H2,1-5H3,(H,39,42)(H,40,44) |
| InChIKey | WHOULFMUKKSHKF-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.84 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|