C36H53N3O4 — CID 18217250
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217250) has the molecular formula C36H53N3O4 and a molecular weight of 591.84 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217250 |
| Molecular Formula | C36H53N3O4 |
| Molecular Weight | 591.84 g/mol |
| Exact Mass | 591.40 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1cccc(C)c1C |
| InChI | InChI=1S/C36H53N3O4/c1-7-8-9-16-24-39(34(41)31(25-28-19-12-10-13-20-28)38-35(42)43-36(4,5)6)32(30-23-17-18-26(2)27(30)3)33(40)37-29-21-14-11-15-22-29/h10,12-13,17-20,23,29,31-32H,7-9,11,14-16,21-22,24-25H2,1-6H3,(H,37,40)(H,38,42) |
| InChIKey | IYVPDFOSZWAYKY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.84 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|