C29H47N3O7S — CID 18060426
ethyl 3-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]propanoate (PubChem CID 18060426) has the molecular formula C29H47N3O7S and a molecular weight of 581.78 g/mol. Its IUPAC name is ethyl 3-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18060426 |
| Molecular Formula | C29H47N3O7S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | ethyl 3-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]propanoate |
| SMILES | CCCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1ccccc1O |
| InChI | InChI=1S/C29H47N3O7S/c1-6-8-9-10-11-14-19-32(27(36)22(20-40)31-28(37)39-29(3,4)5)25(21-15-12-13-16-23(21)33)26(35)30-18-17-24(34)38-7-2/h12-13,15-16,22,25,33,40H,6-11,14,17-20H2,1-5H3,(H,30,35)(H,31,37) |
| InChIKey | KBWRJKHWVCQUCV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|