C22H33N3O7S — CID 18057007
methyl 2-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-propylamino]acetyl]amino]acetate (PubChem CID 18057007) has the molecular formula C22H33N3O7S and a molecular weight of 483.59 g/mol. Its IUPAC name is methyl 2-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-propylamino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-propylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18057007 |
| Molecular Formula | C22H33N3O7S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | methyl 2-[[2-(2-hydroxyphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-propylamino]acetyl]amino]acetate |
| SMILES | CCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1ccccc1O |
| InChI | InChI=1S/C22H33N3O7S/c1-6-11-25(20(29)15(13-33)24-21(30)32-22(2,3)4)18(14-9-7-8-10-16(14)26)19(28)23-12-17(27)31-5/h7-10,15,18,26,33H,6,11-13H2,1-5H3,(H,23,28)(H,24,30) |
| InChIKey | PUXOEPPYVDBDPK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|