C29H41N3O6 — CID 18068395
tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18068395) has the molecular formula C29H41N3O6 and a molecular weight of 527.66 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18068395 |
| Molecular Formula | C29H41N3O6 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccccc1O)N(CCC)C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41N3O6/c1-6-8-17-30-26(35)25(22-11-9-10-12-24(22)34)32(18-7-2)27(36)23(31-28(37)38-29(3,4)5)19-20-13-15-21(33)16-14-20/h9-16,23,25,33-34H,6-8,17-19H2,1-5H3,(H,30,35)(H,31,37) |
| InChIKey | OFWAAUZLNVMLBC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|