C30H43N3O6 — CID 18210497
tert-butyl N-[1-[butan-2-yl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18210497) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is tert-butyl N-[1-[butan-2-yl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butan-2-yl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18210497 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | tert-butyl N-[1-[butan-2-yl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccccc1O)N(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C30H43N3O6/c1-7-9-18-31-27(36)26(23-12-10-11-13-25(23)35)33(20(3)8-2)28(37)24(32-29(38)39-30(4,5)6)19-21-14-16-22(34)17-15-21/h10-17,20,24,26,34-35H,7-9,18-19H2,1-6H3,(H,31,36)(H,32,38) |
| InChIKey | MFAMQFKMCSPYBQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|