C26H40N4O8 — CID 18053872
methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-hydroxyphenyl)acetyl]amino]acetate (PubChem CID 18053872) has the molecular formula C26H40N4O8 and a molecular weight of 536.63 g/mol. Its IUPAC name is methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-hydroxyphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-hydroxyphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18053872 |
| Molecular Formula | C26H40N4O8 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-hydroxyphenyl)acetyl]amino]acetate |
| SMILES | CCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1ccccc1O |
| InChI | InChI=1S/C26H40N4O8/c1-6-7-8-11-14-30(24(35)18(15-20(27)32)29-25(36)38-26(2,3)4)22(17-12-9-10-13-19(17)31)23(34)28-16-21(33)37-5/h9-10,12-13,18,22,31H,6-8,11,14-16H2,1-5H3,(H2,27,32)(H,28,34)(H,29,36) |
| InChIKey | MUSIWGPXNHNZQC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|