C24H38N4O7 — CID 18051012
tert-butyl N-[4-amino-1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18051012) has the molecular formula C24H38N4O7 and a molecular weight of 494.59 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18051012 |
| Molecular Formula | C24H38N4O7 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | tert-butyl N-[4-amino-1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1O)N(CCO)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N4O7/c1-5-6-9-12-26-21(32)20(16-10-7-8-11-18(16)30)28(13-14-29)22(33)17(15-19(25)31)27-23(34)35-24(2,3)4/h7-8,10-11,17,20,29-30H,5-6,9,12-15H2,1-4H3,(H2,25,31)(H,26,32)(H,27,34) |
| InChIKey | ZEOGOBJGUFRMBM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|