C25H41N3O6S — CID 18028212
tert-butyl N-[1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18028212) has the molecular formula C25H41N3O6S and a molecular weight of 511.69 g/mol. Its IUPAC name is tert-butyl N-[1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18028212 |
| Molecular Formula | C25H41N3O6S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | tert-butyl N-[1-[2-hydroxyethyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1O)N(CCO)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H41N3O6S/c1-6-7-10-14-26-22(31)21(18-11-8-9-12-20(18)30)28(15-16-29)23(32)19(13-17-35-5)27-24(33)34-25(2,3)4/h8-9,11-12,19,21,29-30H,6-7,10,13-17H2,1-5H3,(H,26,31)(H,27,33) |
| InChIKey | MDVYWSVQIVGVBH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|