C27H45N3O5S — CID 18029922
tert-butyl N-[1-[butyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18029922) has the molecular formula C27H45N3O5S and a molecular weight of 523.74 g/mol. Its IUPAC name is tert-butyl N-[1-[butyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18029922 |
| Molecular Formula | C27H45N3O5S |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | tert-butyl N-[1-[butyl-[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1O)N(CCCC)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H45N3O5S/c1-7-9-13-17-28-24(32)23(20-14-11-12-15-22(20)31)30(18-10-8-2)25(33)21(16-19-36-6)29-26(34)35-27(3,4)5/h11-12,14-15,21,23,31H,7-10,13,16-19H2,1-6H3,(H,28,32)(H,29,34) |
| InChIKey | UDAMIGZDRUIPDS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|