C28H47N3O4S — CID 18030477
tert-butyl N-[4-methylsulfanyl-1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-pentylamino]butan-2-yl]carbamate (PubChem CID 18030477) has the molecular formula C28H47N3O4S and a molecular weight of 521.77 g/mol. Its IUPAC name is tert-butyl N-[4-methylsulfanyl-1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-pentylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-methylsulfanyl-1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-pentylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 18030477 |
| Molecular Formula | C28H47N3O4S |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | tert-butyl N-[4-methylsulfanyl-1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-pentylamino]butan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(CCCCC)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H47N3O4S/c1-7-9-14-19-29-25(32)24(22-16-12-11-13-17-22)31(20-15-10-8-2)26(33)23(18-21-36-6)30-27(34)35-28(3,4)5/h11-13,16-17,23-24H,7-10,14-15,18-21H2,1-6H3,(H,29,32)(H,30,34) |
| InChIKey | QHVFIUITRYYZCM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|