C32H55N3O5 — CID 18049017
tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18049017) has the molecular formula C32H55N3O5 and a molecular weight of 561.81 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18049017 |
| Molecular Formula | C32H55N3O5 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 561.41 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccccc1O |
| InChI | InChI=1S/C32H55N3O5/c1-8-10-12-13-14-18-22-35(30(38)26(23-24(3)4)34-31(39)40-32(5,6)7)28(25-19-15-16-20-27(25)36)29(37)33-21-17-11-9-2/h15-16,19-20,24,26,28,36H,8-14,17-18,21-23H2,1-7H3,(H,33,37)(H,34,39) |
| InChIKey | QOOAWBHXZIFING-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|