C28H47N3O5S — CID 18030491
tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18030491) has the molecular formula C28H47N3O5S and a molecular weight of 537.77 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18030491 |
| Molecular Formula | C28H47N3O5S |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-hydroxyphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(CCSC)NC(=O)OC(C)(C)C)C(C(=O)NC(C)CCC)c1ccccc1O |
| InChI | InChI=1S/C28H47N3O5S/c1-8-10-13-18-31(26(34)22(17-19-37-7)30-27(35)36-28(4,5)6)24(21-15-11-12-16-23(21)32)25(33)29-20(3)14-9-2/h11-12,15-16,20,22,24,32H,8-10,13-14,17-19H2,1-7H3,(H,29,33)(H,30,35) |
| InChIKey | XIKAGIAPLQKKKS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|