C31H49N3O4S — CID 18031166
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18031166) has the molecular formula C31H49N3O4S and a molecular weight of 559.82 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18031166 |
| Molecular Formula | C31H49N3O4S |
| Molecular Weight | 559.82 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC(C)CCC)N(CCCCCC)C(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H49N3O4S/c1-9-12-13-16-21-34(29(36)26(20-22-39-8)33-30(37)38-31(5,6)7)27(28(35)32-23(4)17-10-2)25-19-15-14-18-24(25)11-3/h3,14-15,18-19,23,26-27H,9-10,12-13,16-17,20-22H2,1-2,4-8H3,(H,32,35)(H,33,37) |
| InChIKey | BULOCHHLGPFSFR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.82 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|