C32H51N3O4 — CID 18049118
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18049118) has the molecular formula C32H51N3O4 and a molecular weight of 541.78 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18049118 |
| Molecular Formula | C32H51N3O4 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.39 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC(C)C)N(CCCCCCCC)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H51N3O4/c1-10-12-13-14-15-18-21-35(30(37)27(22-23(3)4)34-31(38)39-32(7,8)9)28(29(36)33-24(5)6)26-20-17-16-19-25(26)11-2/h2,16-17,19-20,23-24,27-28H,10,12-15,18,21-22H2,1,3-9H3,(H,33,36)(H,34,38) |
| InChIKey | GPZHHBLRWMACER-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|