C27H41N3O4S — CID 18059663
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-hexylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18059663) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-hexylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-hexylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18059663 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-hexylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC(C)C)N(CCCCCC)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H41N3O4S/c1-8-10-11-14-17-30(25(32)22(18-35)29-26(33)34-27(5,6)7)23(24(31)28-19(3)4)21-16-13-12-15-20(21)9-2/h2,12-13,15-16,19,22-23,35H,8,10-11,14,17-18H2,1,3-7H3,(H,28,31)(H,29,33) |
| InChIKey | BUQKBWGODZTDLI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|