C30H46N4O5 — CID 18065933
tert-butyl N-[5-amino-1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18065933) has the molecular formula C30H46N4O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18065933 |
| Molecular Formula | C30H46N4O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC(C)C)N(CCCCCCC)C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H46N4O5/c1-8-10-11-12-15-20-34(26(27(36)32-21(3)4)23-17-14-13-16-22(23)9-2)28(37)24(18-19-25(31)35)33-29(38)39-30(5,6)7/h2,13-14,16-17,21,24,26H,8,10-12,15,18-20H2,1,3-7H3,(H2,31,35)(H,32,36)(H,33,38) |
| InChIKey | AFNVMSJKOFQZTP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|