C27H39N3O4 — CID 18044843
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18044843) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18044843 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC(C)C)N(CC=C)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H39N3O4/c1-10-16-30(25(32)22(17-18(3)4)29-26(33)34-27(7,8)9)23(24(31)28-19(5)6)21-15-13-12-14-20(21)11-2/h2,10,12-15,18-19,22-23H,1,16-17H2,3-9H3,(H,28,31)(H,29,33) |
| InChIKey | AAFSDTNRMBPXKG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|