C25H37N3O7 — CID 18044752
methyl 2-[[2-(2-hydroxyphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-prop-2-enylamino]acetyl]amino]acetate (PubChem CID 18044752) has the molecular formula C25H37N3O7 and a molecular weight of 491.59 g/mol. Its IUPAC name is methyl 2-[[2-(2-hydroxyphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-prop-2-enylamino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(2-hydroxyphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-prop-2-enylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18044752 |
| Molecular Formula | C25H37N3O7 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | methyl 2-[[2-(2-hydroxyphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-prop-2-enylamino]acetyl]amino]acetate |
| SMILES | C=CCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1ccccc1O |
| InChI | InChI=1S/C25H37N3O7/c1-8-13-28(23(32)18(14-16(2)3)27-24(33)35-25(4,5)6)21(17-11-9-10-12-19(17)29)22(31)26-15-20(30)34-7/h8-12,16,18,21,29H,1,13-15H2,2-7H3,(H,26,31)(H,27,33) |
| InChIKey | MUSKRZPHUOMWEF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|