C29H43N3O4 — CID 18044847
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18044847) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18044847 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCCC)N(CC=C)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H43N3O4/c1-9-12-15-18-30-26(33)25(23-17-14-13-16-22(23)11-3)32(19-10-2)27(34)24(20-21(4)5)31-28(35)36-29(6,7)8/h3,10,13-14,16-17,21,24-25H,2,9,12,15,18-20H2,1,4-8H3,(H,30,33)(H,31,35) |
| InChIKey | JSRJJYLIULDGBG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|