C26H38N4O5 — CID 18049692
tert-butyl N-[4-amino-1-[ethyl-[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18049692) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[ethyl-[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[ethyl-[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18049692 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | tert-butyl N-[4-amino-1-[ethyl-[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCCC)N(CC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N4O5/c1-7-10-13-16-28-23(32)22(19-15-12-11-14-18(19)8-2)30(9-3)24(33)20(17-21(27)31)29-25(34)35-26(4,5)6/h2,11-12,14-15,20,22H,7,9-10,13,16-17H2,1,3-6H3,(H2,27,31)(H,28,32)(H,29,34) |
| InChIKey | MUVXEBPIUZWVGG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|