C37H46N4O5 — CID 18054826
tert-butyl N-[4-amino-1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054826) has the molecular formula C37H46N4O5 and a molecular weight of 626.80 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054826 |
| Molecular Formula | C37H46N4O5 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccc2ccccc2c1)N(CCCCCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H46N4O5/c1-6-8-9-10-11-16-23-41(35(44)31(25-32(38)42)40-36(45)46-37(3,4)5)33(30-20-15-14-17-26(30)7-2)34(43)39-29-22-21-27-18-12-13-19-28(27)24-29/h2,12-15,17-22,24,31,33H,6,8-11,16,23,25H2,1,3-5H3,(H2,38,42)(H,39,43)(H,40,45) |
| InChIKey | YCACMLPONWGTFA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|