C39H49N3O5 — CID 18218021
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18218021) has the molecular formula C39H49N3O5 and a molecular weight of 639.84 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18218021 |
| Molecular Formula | C39H49N3O5 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.37 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccc(OC)cc1)N(CCCCCCCC)C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H49N3O5/c1-7-9-10-11-12-18-27-42(37(44)34(28-29-19-14-13-15-20-29)41-38(45)47-39(3,4)5)35(33-22-17-16-21-30(33)8-2)36(43)40-31-23-25-32(46-6)26-24-31/h2,13-17,19-26,34-35H,7,9-12,18,27-28H2,1,3-6H3,(H,40,43)(H,41,45) |
| InChIKey | VMPSNDBJSFSGMU-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|