C38H46ClN3O4 — CID 18217734
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217734) has the molecular formula C38H46ClN3O4 and a molecular weight of 644.26 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217734 |
| Molecular Formula | C38H46ClN3O4 |
| Molecular Weight | 644.26 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1c(C)cccc1Cl)N(CCCCCCC)C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H46ClN3O4/c1-7-9-10-11-17-25-42(36(44)32(26-28-20-13-12-14-21-28)40-37(45)46-38(4,5)6)34(30-23-16-15-22-29(30)8-2)35(43)41-33-27(3)19-18-24-31(33)39/h2,12-16,18-24,32,34H,7,9-11,17,25-26H2,1,3-6H3,(H,40,45)(H,41,43) |
| InChIKey | JZMRTGOCUPBXAI-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.26 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|