C33H33ClN4O4 — CID 18213459
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18213459) has the molecular formula C33H33ClN4O4 and a molecular weight of 585.10 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18213459 |
| Molecular Formula | C33H33ClN4O4 |
| Molecular Weight | 585.10 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1c(C)cccc1Cl)N(CC#N)C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H33ClN4O4/c1-6-24-16-10-11-17-25(24)29(30(39)37-28-22(2)13-12-18-26(28)34)38(20-19-35)31(40)27(21-23-14-8-7-9-15-23)36-32(41)42-33(3,4)5/h1,7-18,27,29H,20-21H2,2-5H3,(H,36,41)(H,37,39) |
| InChIKey | AQHSPVAICDJEKW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.10 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|