C27H32ClN3O4S — CID 18055397
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18055397) has the molecular formula C27H32ClN3O4S and a molecular weight of 530.09 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18055397 |
| Molecular Formula | C27H32ClN3O4S |
| Molecular Weight | 530.09 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2-ethynylphenyl)-2-oxoethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1c(C)cccc1Cl)N(CC)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H32ClN3O4S/c1-7-18-13-9-10-14-19(18)23(24(32)30-22-17(3)12-11-15-20(22)28)31(8-2)25(33)21(16-36)29-26(34)35-27(4,5)6/h1,9-15,21,23,36H,8,16H2,2-6H3,(H,29,34)(H,30,32) |
| InChIKey | HOSYVWFIKYXUFZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.09 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|