C40H45N3O4 — CID 18217163
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217163) has the molecular formula C40H45N3O4 and a molecular weight of 631.82 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217163 |
| Molecular Formula | C40H45N3O4 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccc2ccccc2c1)N(CCCCCC)C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H45N3O4/c1-6-8-9-17-26-43(38(45)35(27-29-18-11-10-12-19-29)42-39(46)47-40(3,4)5)36(34-23-16-15-20-30(34)7-2)37(44)41-33-25-24-31-21-13-14-22-32(31)28-33/h2,10-16,18-25,28,35-36H,6,8-9,17,26-27H2,1,3-5H3,(H,41,44)(H,42,46) |
| InChIKey | RDKYUJQWXJPDNM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|