C38H45N3O6 — CID 18211358
tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18211358) has the molecular formula C38H45N3O6 and a molecular weight of 639.79 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18211358 |
| Molecular Formula | C38H45N3O6 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccccc1O |
| InChI | InChI=1S/C38H45N3O6/c1-5-6-7-12-23-41(36(45)32(40-37(46)47-38(2,3)4)24-26-17-21-30(42)22-18-26)34(31-15-10-11-16-33(31)43)35(44)39-29-20-19-27-13-8-9-14-28(27)25-29/h8-11,13-22,25,32,34,42-43H,5-7,12,23-24H2,1-4H3,(H,39,44)(H,40,46) |
| InChIKey | BGULVTLTWCXEPV-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|