C40H49N3O6 — CID 18212093
tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18212093) has the molecular formula C40H49N3O6 and a molecular weight of 667.85 g/mol. Its IUPAC name is tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18212093 |
| Molecular Formula | C40H49N3O6 |
| Molecular Weight | 667.85 g/mol |
| Exact Mass | 667.36 |
| IUPAC Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cccc(C)c1O |
| InChI | InChI=1S/C40H49N3O6/c1-6-7-8-9-12-24-43(38(47)34(42-39(48)49-40(3,4)5)25-28-18-22-32(44)23-19-28)35(33-17-13-14-27(2)36(33)45)37(46)41-31-21-20-29-15-10-11-16-30(29)26-31/h10-11,13-23,26,34-35,44-45H,6-9,12,24-25H2,1-5H3,(H,41,46)(H,42,48) |
| InChIKey | SEHPZIYIESANRN-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.85 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|