C35H46N4O6 — CID 18065431
tert-butyl N-[5-amino-1-[hexyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18065431) has the molecular formula C35H46N4O6 and a molecular weight of 618.78 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[hexyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[hexyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18065431 |
| Molecular Formula | C35H46N4O6 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | tert-butyl N-[5-amino-1-[hexyl-[1-(2-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cccc(C)c1O |
| InChI | InChI=1S/C35H46N4O6/c1-6-7-8-11-21-39(33(43)28(19-20-29(36)40)38-34(44)45-35(3,4)5)30(27-16-12-13-23(2)31(27)41)32(42)37-26-18-17-24-14-9-10-15-25(24)22-26/h9-10,12-18,22,28,30,41H,6-8,11,19-21H2,1-5H3,(H2,36,40)(H,37,42)(H,38,44) |
| InChIKey | OSXXFCUNXQHOPG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|