C34H44N4O6 — CID 18054436
tert-butyl N-[4-amino-1-[heptyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054436) has the molecular formula C34H44N4O6 and a molecular weight of 604.75 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[heptyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[heptyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054436 |
| Molecular Formula | C34H44N4O6 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | tert-butyl N-[4-amino-1-[heptyl-[1-(2-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccccc1O |
| InChI | InChI=1S/C34H44N4O6/c1-5-6-7-8-13-20-38(32(42)27(22-29(35)40)37-33(43)44-34(2,3)4)30(26-16-11-12-17-28(26)39)31(41)36-25-19-18-23-14-9-10-15-24(23)21-25/h9-12,14-19,21,27,30,39H,5-8,13,20,22H2,1-4H3,(H2,35,40)(H,36,41)(H,37,43) |
| InChIKey | LUYXBQBDRPSKQJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|