C33H48N4O7 — CID 18066124
tert-butyl N-[5-amino-1-[[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18066124) has the molecular formula C33H48N4O7 and a molecular weight of 612.77 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18066124 |
| Molecular Formula | C33H48N4O7 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccccc1O |
| InChI | InChI=1S/C33H48N4O7/c1-6-7-8-9-10-13-22-37(31(41)26(20-21-28(34)39)36-32(42)44-33(2,3)4)29(25-14-11-12-15-27(25)38)30(40)35-23-16-18-24(43-5)19-17-23/h11-12,14-19,26,29,38H,6-10,13,20-22H2,1-5H3,(H2,34,39)(H,35,40)(H,36,42) |
| InChIKey | YIGQIWSXIFRKGA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|