C30H50N4O6 — CID 18066114
tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18066114) has the molecular formula C30H50N4O6 and a molecular weight of 562.75 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18066114 |
| Molecular Formula | C30H50N4O6 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.37 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)c1ccccc1O |
| InChI | InChI=1S/C30H50N4O6/c1-8-9-10-11-12-15-20-34(25(26(37)33-29(2,3)4)21-16-13-14-17-23(21)35)27(38)22(18-19-24(31)36)32-28(39)40-30(5,6)7/h13-14,16-17,22,25,35H,8-12,15,18-20H2,1-7H3,(H2,31,36)(H,32,39)(H,33,37) |
| InChIKey | GESNTIQFXYUVQC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|