C32H54N4O5 — CID 18066249
tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18066249) has the molecular formula C32H54N4O5 and a molecular weight of 574.81 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18066249 |
| Molecular Formula | C32H54N4O5 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.41 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C32H54N4O5/c1-9-11-12-13-14-15-22-36(29(39)25(20-21-26(33)37)34-30(40)41-32(6,7)8)27(28(38)35-31(3,4)5)24-18-16-23(10-2)17-19-24/h16-19,25,27H,9-15,20-22H2,1-8H3,(H2,33,37)(H,34,40)(H,35,38) |
| InChIKey | BJFSEOIFXKBRRF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|