C29H48N4O6 — CID 18065905
tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18065905) has the molecular formula C29H48N4O6 and a molecular weight of 548.73 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18065905 |
| Molecular Formula | C29H48N4O6 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCCCC)c1ccc(O)cc1 |
| InChI | InChI=1S/C29H48N4O6/c1-6-8-10-11-12-20-33(25(26(36)31-19-9-7-2)21-13-15-22(34)16-14-21)27(37)23(17-18-24(30)35)32-28(38)39-29(3,4)5/h13-16,23,25,34H,6-12,17-20H2,1-5H3,(H2,30,35)(H,31,36)(H,32,38) |
| InChIKey | NPDOJADBMPZSAI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|