C31H52N4O5 — CID 18066145
tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18066145) has the molecular formula C31H52N4O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18066145 |
| Molecular Formula | C31H52N4O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCCCC)c1cccc(C)c1 |
| InChI | InChI=1S/C31H52N4O5/c1-7-9-11-12-13-14-21-35(27(28(37)33-20-10-8-2)24-17-15-16-23(3)22-24)29(38)25(18-19-26(32)36)34-30(39)40-31(4,5)6/h15-17,22,25,27H,7-14,18-21H2,1-6H3,(H2,32,36)(H,33,37)(H,34,39) |
| InChIKey | WMOMLDXKEQQZSK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|