C29H48N4O5 — CID 18064722
tert-butyl N-[5-amino-1-[[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18064722) has the molecular formula C29H48N4O5 and a molecular weight of 532.73 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18064722 |
| Molecular Formula | C29H48N4O5 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-pentylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1cccc(C)c1)N(CCCCC)C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H48N4O5/c1-7-9-11-18-31-26(35)25(22-15-13-14-21(3)20-22)33(19-12-10-8-2)27(36)23(16-17-24(30)34)32-28(37)38-29(4,5)6/h13-15,20,23,25H,7-12,16-19H2,1-6H3,(H2,30,34)(H,31,35)(H,32,37) |
| InChIKey | BZLYSEJGBDBBPQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|