C25H41N3O5S — CID 18059065
tert-butyl N-[1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18059065) has the molecular formula C25H41N3O5S and a molecular weight of 495.69 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18059065 |
| Molecular Formula | C25H41N3O5S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCCCC)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H41N3O5S/c1-6-8-10-16-28(23(31)20(17-34)27-24(32)33-25(3,4)5)21(22(30)26-15-9-7-2)18-11-13-19(29)14-12-18/h11-14,20-21,29,34H,6-10,15-17H2,1-5H3,(H,26,30)(H,27,32) |
| InChIKey | ZEAWTHTXSFGVGW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|