C24H39N3O4S — CID 18056982
tert-butyl N-[1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056982) has the molecular formula C24H39N3O4S and a molecular weight of 465.66 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056982 |
| Molecular Formula | C24H39N3O4S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | tert-butyl N-[1-oxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(CCC)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N3O4S/c1-6-8-12-15-25-21(28)20(18-13-10-9-11-14-18)27(16-7-2)22(29)19(17-32)26-23(30)31-24(3,4)5/h9-11,13-14,19-20,32H,6-8,12,15-17H2,1-5H3,(H,25,28)(H,26,30) |
| InChIKey | CTCWVFJAWWSKOE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|