C28H47N3O4S — CID 18059607
tert-butyl N-[1-[hexyl-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18059607) has the molecular formula C28H47N3O4S and a molecular weight of 521.77 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18059607 |
| Molecular Formula | C28H47N3O4S |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H47N3O4S/c1-7-9-11-13-19-31(26(33)23(20-36)30-27(34)35-28(4,5)6)24(22-16-14-21(3)15-17-22)25(32)29-18-12-10-8-2/h14-17,23-24,36H,7-13,18-20H2,1-6H3,(H,29,32)(H,30,34) |
| InChIKey | PXBKBVFRIPAJAH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|