C30H50N4O5 — CID 18054702
tert-butyl N-[4-amino-1-[octyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054702) has the molecular formula C30H50N4O5 and a molecular weight of 546.75 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[octyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[octyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054702 |
| Molecular Formula | C30H50N4O5 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | tert-butyl N-[4-amino-1-[octyl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccccc1 |
| InChI | InChI=1S/C30H50N4O5/c1-6-8-10-11-12-17-21-34(28(37)24(22-25(31)35)33-29(38)39-30(3,4)5)26(23-18-14-13-15-19-23)27(36)32-20-16-9-7-2/h13-15,18-19,24,26H,6-12,16-17,20-22H2,1-5H3,(H2,31,35)(H,32,36)(H,33,38) |
| InChIKey | NQKKRDHKNDONGX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|