C31H44N4O5 — CID 18053853
tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18053853) has the molecular formula C31H44N4O5 and a molecular weight of 552.72 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18053853 |
| Molecular Formula | C31H44N4O5 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccccc1 |
| InChI | InChI=1S/C31H44N4O5/c1-7-8-9-13-19-35(29(38)24(20-25(32)36)33-30(39)40-31(4,5)6)27(23-17-11-10-12-18-23)28(37)34-26-21(2)15-14-16-22(26)3/h10-12,14-18,24,27H,7-9,13,19-20H2,1-6H3,(H2,32,36)(H,33,39)(H,34,37) |
| InChIKey | CIXGCPAMHPLRRW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|